C17H16ClN3O4S — CID 22516485
N-[(2-chlorophenyl)methyl]-3-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide (PubChem CID 22516485) has the molecular formula C17H16ClN3O4S and a molecular weight of 393.85 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
|---|---|
| PubChem CID | 22516485 |
| Molecular Formula | C17H16ClN3O4S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
| SMILES | CC1C(=O)Nc2ccc(S(=O)(=O)NCc3ccccc3Cl)cc2NC1=O |
| InChI | InChI=1S/C17H16ClN3O4S/c1-10-16(22)20-14-7-6-12(8-15(14)21-17(10)23)26(24,25)19-9-11-4-2-3-5-13(11)18/h2-8,10,19H,9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | CSTUMLMQLANOHQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|