C15H12N4O4S2 — CID 22517604
N-[5-(2,3-dihydroindol-1-ylsulfonyl)-1,3,4-thiadiazol-2-yl]furan-2-carboxamide (PubChem CID 22517604) has the molecular formula C15H12N4O4S2 and a molecular weight of 376.42 g/mol. Its IUPAC name is N-[5-(2,3-dihydroindol-1-ylsulfonyl)-1,3,4-thiadiazol-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-(2,3-dihydroindol-1-ylsulfonyl)-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 22517604 |
| Molecular Formula | C15H12N4O4S2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | N-[5-(2,3-dihydroindol-1-ylsulfonyl)-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)N2CCc3ccccc32)s1)c1ccco1 |
| InChI | InChI=1S/C15H12N4O4S2/c20-13(12-6-3-9-23-12)16-14-17-18-15(24-14)25(21,22)19-8-7-10-4-1-2-5-11(10)19/h1-6,9H,7-8H2,(H,16,17,20) |
| InChIKey | KOUSPSUIHVZRKJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|