C22H20N4O2S — CID 22518654
2-[(3-methoxyphenyl)methylsulfanyl]-3-[(4-methylphenyl)methyl]pteridin-4-one (PubChem CID 22518654) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methylsulfanyl]-3-[(4-methylphenyl)methyl]pteridin-4-one.
| Compound Name | 2-[(3-methoxyphenyl)methylsulfanyl]-3-[(4-methylphenyl)methyl]pteridin-4-one |
|---|---|
| PubChem CID | 22518654 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-[(3-methoxyphenyl)methylsulfanyl]-3-[(4-methylphenyl)methyl]pteridin-4-one |
| SMILES | COc1cccc(CSc2nc3nccnc3c(=O)n2Cc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H20N4O2S/c1-15-6-8-16(9-7-15)13-26-21(27)19-20(24-11-10-23-19)25-22(26)29-14-17-4-3-5-18(12-17)28-2/h3-12H,13-14H2,1-2H3 |
| InChIKey | QYPBNGVJNAOLKL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |