C19H22N4O2S — CID 22518483
2-[(3-methoxyphenyl)methylsulfanyl]-3-(3-methylbutyl)pteridin-4-one (PubChem CID 22518483) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methylsulfanyl]-3-(3-methylbutyl)pteridin-4-one.
| Compound Name | 2-[(3-methoxyphenyl)methylsulfanyl]-3-(3-methylbutyl)pteridin-4-one |
|---|---|
| PubChem CID | 22518483 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[(3-methoxyphenyl)methylsulfanyl]-3-(3-methylbutyl)pteridin-4-one |
| SMILES | COc1cccc(CSc2nc3nccnc3c(=O)n2CCC(C)C)c1 |
| InChI | InChI=1S/C19H22N4O2S/c1-13(2)7-10-23-18(24)16-17(21-9-8-20-16)22-19(23)26-12-14-5-4-6-15(11-14)25-3/h4-6,8-9,11,13H,7,10,12H2,1-3H3 |
| InChIKey | BVOSPVSFCFJRNI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |