C19H20FN5O2S — CID 22518474
N-(4-fluorophenyl)-2-[3-(3-methylbutyl)-4-oxopteridin-2-yl]sulfanylacetamide (PubChem CID 22518474) has the molecular formula C19H20FN5O2S and a molecular weight of 401.47 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[3-(3-methylbutyl)-4-oxopteridin-2-yl]sulfanylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[3-(3-methylbutyl)-4-oxopteridin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 22518474 |
| Molecular Formula | C19H20FN5O2S |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-(4-fluorophenyl)-2-[3-(3-methylbutyl)-4-oxopteridin-2-yl]sulfanylacetamide |
| SMILES | CC(C)CCn1c(SCC(=O)Nc2ccc(F)cc2)nc2nccnc2c1=O |
| InChI | InChI=1S/C19H20FN5O2S/c1-12(2)7-10-25-18(27)16-17(22-9-8-21-16)24-19(25)28-11-15(26)23-14-5-3-13(20)4-6-14/h3-6,8-9,12H,7,10-11H2,1-2H3,(H,23,26) |
| InChIKey | UDQOVRGGLMUCCI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |