C24H22FN5O2S — CID 51460604
(2R)-N-(4-fluorophenyl)-2-[4-oxo-3-(2-phenylethyl)pteridin-2-yl]sulfanylbutanamide (PubChem CID 51460604) has the molecular formula C24H22FN5O2S and a molecular weight of 463.54 g/mol. Its IUPAC name is (2R)-N-(4-fluorophenyl)-2-[4-oxo-3-(2-phenylethyl)pteridin-2-yl]sulfanylbutanamide.
| Compound Name | (2R)-N-(4-fluorophenyl)-2-[4-oxo-3-(2-phenylethyl)pteridin-2-yl]sulfanylbutanamide |
|---|---|
| PubChem CID | 51460604 |
| Molecular Formula | C24H22FN5O2S |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (2R)-N-(4-fluorophenyl)-2-[4-oxo-3-(2-phenylethyl)pteridin-2-yl]sulfanylbutanamide |
| SMILES | CC[C@@H](Sc1nc2nccnc2c(=O)n1CCc1ccccc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H22FN5O2S/c1-2-19(22(31)28-18-10-8-17(25)9-11-18)33-24-29-21-20(26-13-14-27-21)23(32)30(24)15-12-16-6-4-3-5-7-16/h3-11,13-14,19H,2,12,15H2,1H3,(H,28,31)/t19-/m1/s1 |
| InChIKey | KAOZMBRCGWQPGF-LJQANCHMSA-N |
| XLogP | 4.08 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |