C26H27N5O3S — CID 22518349
N-(4-ethylphenyl)-2-[3-[(4-methoxyphenyl)methyl]-4-oxopteridin-2-yl]sulfanylbutanamide (PubChem CID 22518349) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[3-[(4-methoxyphenyl)methyl]-4-oxopteridin-2-yl]sulfanylbutanamide.
| Compound Name | N-(4-ethylphenyl)-2-[3-[(4-methoxyphenyl)methyl]-4-oxopteridin-2-yl]sulfanylbutanamide |
|---|---|
| PubChem CID | 22518349 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-(4-ethylphenyl)-2-[3-[(4-methoxyphenyl)methyl]-4-oxopteridin-2-yl]sulfanylbutanamide |
| SMILES | CCc1ccc(NC(=O)C(CC)Sc2nc3nccnc3c(=O)n2Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H27N5O3S/c1-4-17-6-10-19(11-7-17)29-24(32)21(5-2)35-26-30-23-22(27-14-15-28-23)25(33)31(26)16-18-8-12-20(34-3)13-9-18/h6-15,21H,4-5,16H2,1-3H3,(H,29,32) |
| InChIKey | LQCQGULHPIHPDU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |