C25H25N5O2S — CID 51460602
(2R)-N-(4-methylphenyl)-2-[4-oxo-3-(2-phenylethyl)pteridin-2-yl]sulfanylbutanamide (PubChem CID 51460602) has the molecular formula C25H25N5O2S and a molecular weight of 459.58 g/mol. Its IUPAC name is (2R)-N-(4-methylphenyl)-2-[4-oxo-3-(2-phenylethyl)pteridin-2-yl]sulfanylbutanamide.
| Compound Name | (2R)-N-(4-methylphenyl)-2-[4-oxo-3-(2-phenylethyl)pteridin-2-yl]sulfanylbutanamide |
|---|---|
| PubChem CID | 51460602 |
| Molecular Formula | C25H25N5O2S |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (2R)-N-(4-methylphenyl)-2-[4-oxo-3-(2-phenylethyl)pteridin-2-yl]sulfanylbutanamide |
| SMILES | CC[C@@H](Sc1nc2nccnc2c(=O)n1CCc1ccccc1)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C25H25N5O2S/c1-3-20(23(31)28-19-11-9-17(2)10-12-19)33-25-29-22-21(26-14-15-27-22)24(32)30(25)16-13-18-7-5-4-6-8-18/h4-12,14-15,20H,3,13,16H2,1-2H3,(H,28,31)/t20-/m1/s1 |
| InChIKey | LCFHDLHEGLTJCZ-HXUWFJFHSA-N |
| XLogP | 4.25 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |