C22H17FN4O2S — CID 146271731
2-[2-(2-fluorophenyl)-2-oxoethyl]sulfanyl-3-(2-phenylethyl)pteridin-4-one (PubChem CID 146271731) has the molecular formula C22H17FN4O2S and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)-2-oxoethyl]sulfanyl-3-(2-phenylethyl)pteridin-4-one.
| Compound Name | 2-[2-(2-fluorophenyl)-2-oxoethyl]sulfanyl-3-(2-phenylethyl)pteridin-4-one |
|---|---|
| PubChem CID | 146271731 |
| Molecular Formula | C22H17FN4O2S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-[2-(2-fluorophenyl)-2-oxoethyl]sulfanyl-3-(2-phenylethyl)pteridin-4-one |
| SMILES | O=C(CSc1nc2nccnc2c(=O)n1CCc1ccccc1)c1ccccc1F |
| InChI | InChI=1S/C22H17FN4O2S/c23-17-9-5-4-8-16(17)18(28)14-30-22-26-20-19(24-11-12-25-20)21(29)27(22)13-10-15-6-2-1-3-7-15/h1-9,11-12H,10,13-14H2 |
| InChIKey | QXXKPAQNBMTUGU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |