C26H20N6O4S2 — CID 167629532
2-[3-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-oxopropyl]sulfanyl-3-(2-phenylethyl)pteridin-4-one (PubChem CID 167629532) has the molecular formula C26H20N6O4S2 and a molecular weight of 544.62 g/mol. Its IUPAC name is 2-[3-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-oxopropyl]sulfanyl-3-(2-phenylethyl)pteridin-4-one.
| Compound Name | 2-[3-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-oxopropyl]sulfanyl-3-(2-phenylethyl)pteridin-4-one |
|---|---|
| PubChem CID | 167629532 |
| Molecular Formula | C26H20N6O4S2 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 2-[3-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-oxopropyl]sulfanyl-3-(2-phenylethyl)pteridin-4-one |
| SMILES | O=C(CSc1nc2nccnc2c(=O)n1CCc1ccccc1)Cc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C26H20N6O4S2/c33-20(14-22-29-21(16-37-22)18-7-4-8-19(13-18)32(35)36)15-38-26-30-24-23(27-10-11-28-24)25(34)31(26)12-9-17-5-2-1-3-6-17/h1-8,10-11,13,16H,9,12,14-15H2 |
| InChIKey | QWXUIHLZFDVTKY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 133.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|