C17H21N7O2S — CID 22518472
2-[3-(3-methylbutyl)-4-oxopteridin-2-yl]sulfanyl-N-(5-methyl-1H-pyrazol-3-yl)acetamide (PubChem CID 22518472) has the molecular formula C17H21N7O2S and a molecular weight of 387.47 g/mol. Its IUPAC name is 2-[3-(3-methylbutyl)-4-oxopteridin-2-yl]sulfanyl-N-(5-methyl-1H-pyrazol-3-yl)acetamide.
| Compound Name | 2-[3-(3-methylbutyl)-4-oxopteridin-2-yl]sulfanyl-N-(5-methyl-1H-pyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 22518472 |
| Molecular Formula | C17H21N7O2S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-[3-(3-methylbutyl)-4-oxopteridin-2-yl]sulfanyl-N-(5-methyl-1H-pyrazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CSc2nc3nccnc3c(=O)n2CCC(C)C)n[nH]1 |
| InChI | InChI=1S/C17H21N7O2S/c1-10(2)4-7-24-16(26)14-15(19-6-5-18-14)21-17(24)27-9-13(25)20-12-8-11(3)22-23-12/h5-6,8,10H,4,7,9H2,1-3H3,(H2,20,22,23,25) |
| InChIKey | BEQPGVUWDWTPHG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |