C20H22ClN5O3S — CID 22518479
N-(5-chloro-2-methoxyphenyl)-2-[3-(3-methylbutyl)-4-oxopteridin-2-yl]sulfanylacetamide (PubChem CID 22518479) has the molecular formula C20H22ClN5O3S and a molecular weight of 447.95 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[3-(3-methylbutyl)-4-oxopteridin-2-yl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[3-(3-methylbutyl)-4-oxopteridin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 22518479 |
| Molecular Formula | C20H22ClN5O3S |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[3-(3-methylbutyl)-4-oxopteridin-2-yl]sulfanylacetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1nc2nccnc2c(=O)n1CCC(C)C |
| InChI | InChI=1S/C20H22ClN5O3S/c1-12(2)6-9-26-19(28)17-18(23-8-7-22-17)25-20(26)30-11-16(27)24-14-10-13(21)4-5-15(14)29-3/h4-5,7-8,10,12H,6,9,11H2,1-3H3,(H,24,27) |
| InChIKey | VLDCTONNSAFHAM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |