C19H21NO3 — CID 22525362
[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 1-benzofuran-2-carboxylate (PubChem CID 22525362) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is [(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 1-benzofuran-2-carboxylate.
| Compound Name | [(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 22525362 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 1-benzofuran-2-carboxylate |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)/C(=N\OC(=O)c1cc3ccccc3o1)C2 |
| InChI | InChI=1S/C19H21NO3/c1-18(2)13-8-9-19(18,3)16(11-13)20-23-17(21)15-10-12-6-4-5-7-14(12)22-15/h4-7,10,13H,8-9,11H2,1-3H3/b20-16-/t13-,19-/m1/s1 |
| InChIKey | PNRLHEDQDUTSJZ-MLNVVSDNSA-N |
| XLogP | 4.79 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|