C17H26N6O3S — CID 2252932
N-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 2252932) has the molecular formula C17H26N6O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2252932 |
| Molecular Formula | C17H26N6O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCOc2nc(N(C)C)nc(N(C)C)n2)c1 |
| InChI | InChI=1S/C17H26N6O3S/c1-12-7-8-13(2)14(11-12)27(24,25)18-9-10-26-17-20-15(22(3)4)19-16(21-17)23(5)6/h7-8,11,18H,9-10H2,1-6H3 |
| InChIKey | AHCXZCYTSUOMOP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|