C18H17N7O3 — CID 22542620
N'-[5-amino-6-(1,3-benzodioxol-5-ylmethylamino)pyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 22542620) has the molecular formula C18H17N7O3 and a molecular weight of 379.38 g/mol. Its IUPAC name is N'-[5-amino-6-(1,3-benzodioxol-5-ylmethylamino)pyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[5-amino-6-(1,3-benzodioxol-5-ylmethylamino)pyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 22542620 |
| Molecular Formula | C18H17N7O3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N'-[5-amino-6-(1,3-benzodioxol-5-ylmethylamino)pyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | Nc1c(NCc2ccc3c(c2)OCO3)ncnc1NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C18H17N7O3/c19-15-16(21-7-11-3-4-13-14(6-11)28-10-27-13)22-9-23-17(15)24-25-18(26)12-2-1-5-20-8-12/h1-6,8-9H,7,10,19H2,(H,25,26)(H2,21,22,23,24) |
| InChIKey | GXIPSZBCIOSBMM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|