C12H16N6 — CID 22543383
4-N-propan-2-yl-6-N-pyridin-4-ylpyrimidine-4,5,6-triamine (PubChem CID 22543383) has the molecular formula C12H16N6 and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-N-propan-2-yl-6-N-pyridin-4-ylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-propan-2-yl-6-N-pyridin-4-ylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22543383 |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 4-N-propan-2-yl-6-N-pyridin-4-ylpyrimidine-4,5,6-triamine |
| SMILES | CC(C)Nc1ncnc(Nc2ccncc2)c1N |
| InChI | InChI=1S/C12H16N6/c1-8(2)17-11-10(13)12(16-7-15-11)18-9-3-5-14-6-4-9/h3-8H,13H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | WFPXASCEWZYGBZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |