C20H14Cl2N4O — CID 22543583
4-N-(3,5-dichlorophenyl)-6-naphthalen-2-yloxypyrimidine-4,5-diamine (PubChem CID 22543583) has the molecular formula C20H14Cl2N4O and a molecular weight of 397.27 g/mol. Its IUPAC name is 4-N-(3,5-dichlorophenyl)-6-naphthalen-2-yloxypyrimidine-4,5-diamine.
| Compound Name | 4-N-(3,5-dichlorophenyl)-6-naphthalen-2-yloxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22543583 |
| Molecular Formula | C20H14Cl2N4O |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 4-N-(3,5-dichlorophenyl)-6-naphthalen-2-yloxypyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2cc(Cl)cc(Cl)c2)ncnc1Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H14Cl2N4O/c21-14-8-15(22)10-16(9-14)26-19-18(23)20(25-11-24-19)27-17-6-5-12-3-1-2-4-13(12)7-17/h1-11H,23H2,(H,24,25,26) |
| InChIKey | QVAACSNQYZGIMP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |