C20H15ClN4O — CID 22543686
4-N-(3-chlorophenyl)-6-naphthalen-2-yloxypyrimidine-4,5-diamine (PubChem CID 22543686) has the molecular formula C20H15ClN4O and a molecular weight of 362.82 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-6-naphthalen-2-yloxypyrimidine-4,5-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-6-naphthalen-2-yloxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22543686 |
| Molecular Formula | C20H15ClN4O |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-N-(3-chlorophenyl)-6-naphthalen-2-yloxypyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2cccc(Cl)c2)ncnc1Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H15ClN4O/c21-15-6-3-7-16(11-15)25-19-18(22)20(24-12-23-19)26-17-9-8-13-4-1-2-5-14(13)10-17/h1-12H,22H2,(H,23,24,25) |
| InChIKey | XPWABSJTXLWKPJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |