C23H21F2NO3 — CID 22556111
N-[[2-(fluoromethyl)-5-methoxyphenyl]methyl]-N-(5-fluoro-2-phenoxyphenyl)acetamide (PubChem CID 22556111) has the molecular formula C23H21F2NO3 and a molecular weight of 397.42 g/mol. Its IUPAC name is N-[[2-(fluoromethyl)-5-methoxyphenyl]methyl]-N-(5-fluoro-2-phenoxyphenyl)acetamide.
| Compound Name | N-[[2-(fluoromethyl)-5-methoxyphenyl]methyl]-N-(5-fluoro-2-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 22556111 |
| Molecular Formula | C23H21F2NO3 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[[2-(fluoromethyl)-5-methoxyphenyl]methyl]-N-(5-fluoro-2-phenoxyphenyl)acetamide |
| SMILES | COc1ccc(CF)c(CN(C(C)=O)c2cc(F)ccc2Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H21F2NO3/c1-16(27)26(15-18-12-21(28-2)10-8-17(18)14-24)22-13-19(25)9-11-23(22)29-20-6-4-3-5-7-20/h3-13H,14-15H2,1-2H3 |
| InChIKey | OYKJGSDMOURKFV-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |