C30H36FN3O4 — CID 71049772
N-[3-[2-[(N-acetyl-5-fluoro-2-phenoxyanilino)methyl]-4-methoxyanilino]-2,3-dimethylbutan-2-yl]acetamide (PubChem CID 71049772) has the molecular formula C30H36FN3O4 and a molecular weight of 521.63 g/mol. Its IUPAC name is N-[3-[2-[(N-acetyl-5-fluoro-2-phenoxyanilino)methyl]-4-methoxyanilino]-2,3-dimethylbutan-2-yl]acetamide.
| Compound Name | N-[3-[2-[(N-acetyl-5-fluoro-2-phenoxyanilino)methyl]-4-methoxyanilino]-2,3-dimethylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 71049772 |
| Molecular Formula | C30H36FN3O4 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | N-[3-[2-[(N-acetyl-5-fluoro-2-phenoxyanilino)methyl]-4-methoxyanilino]-2,3-dimethylbutan-2-yl]acetamide |
| SMILES | COc1ccc(NC(C)(C)C(C)(C)NC(C)=O)c(CN(C(C)=O)c2cc(F)ccc2Oc2ccccc2)c1 |
| InChI | InChI=1S/C30H36FN3O4/c1-20(35)32-29(3,4)30(5,6)33-26-15-14-25(37-7)17-22(26)19-34(21(2)36)27-18-23(31)13-16-28(27)38-24-11-9-8-10-12-24/h8-18,33H,19H2,1-7H3,(H,32,35) |
| InChIKey | YSBUXNREXXCLPC-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|