C29H26FNO4 — CID 59765851
N-(5-fluoro-2-phenoxyphenyl)-N-[(5-methoxy-2-phenylmethoxyphenyl)methyl]acetamide (PubChem CID 59765851) has the molecular formula C29H26FNO4 and a molecular weight of 471.53 g/mol. Its IUPAC name is N-(5-fluoro-2-phenoxyphenyl)-N-[(5-methoxy-2-phenylmethoxyphenyl)methyl]acetamide.
| Compound Name | N-(5-fluoro-2-phenoxyphenyl)-N-[(5-methoxy-2-phenylmethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 59765851 |
| Molecular Formula | C29H26FNO4 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-(5-fluoro-2-phenoxyphenyl)-N-[(5-methoxy-2-phenylmethoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(OCc2ccccc2)c(CN(C(C)=O)c2cc(F)ccc2Oc2ccccc2)c1 |
| InChI | InChI=1S/C29H26FNO4/c1-21(32)31(27-18-24(30)13-15-29(27)35-25-11-7-4-8-12-25)19-23-17-26(33-2)14-16-28(23)34-20-22-9-5-3-6-10-22/h3-18H,19-20H2,1-2H3 |
| InChIKey | AOAFYUUCGXWHDK-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |