About ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane
ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (PubChem CID 22556407) has the molecular formula C12H30O4
and a molecular weight of 238.37 g/mol. Its IUPAC name is ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
Molecular Properties
| Compound Name | ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| PubChem CID | 22556407 |
| Molecular Formula | C12H30O4 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.21 |
| IUPAC Name | ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| SMILES | CC(C)(C)OC(C)(C)C.COC.OCCO |
| InChI | InChI=1S/C8H18O.C2H6O2.C2H6O/c1-7(2,3)9-8(4,5)6;3-1-2-4;1-3-2/h1-6H3;3-4H,1-2H2;1-2H3 |
| InChIKey | UBKKCIWQAUTUCM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The IUPAC name of ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (CID 22556407) is ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
What is the SMILES notation for ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The canonical SMILES for ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane is CC(C)(C)OC(C)(C)C.COC.OCCO.
What is the InChIKey of ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The InChIKey is UBKKCIWQAUTUCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.C2H6O2.C2H6O/c1-7(2,3)9-8(4,5)6;3-1-2-4;1-3-2/h1-6H3;3-4H,1-2H2;1-2H3.
What are the key properties of ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane has a molecular weight of 238.37 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;methoxymethane;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane is sourced from PubChem (CID 22556407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).