C20H16Cl2N2O4 — CID 2255763
[4-[(Z)-[1-(3,4-dichlorophenyl)-3-methylidene-5-oxopyrazolidin-4-ylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 2255763) has the molecular formula C20H16Cl2N2O4 and a molecular weight of 419.26 g/mol. Its IUPAC name is [4-[(Z)-[1-(3,4-dichlorophenyl)-3-methylidene-5-oxopyrazolidin-4-ylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[1-(3,4-dichlorophenyl)-3-methylidene-5-oxopyrazolidin-4-ylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 2255763 |
| Molecular Formula | C20H16Cl2N2O4 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | [4-[(Z)-[1-(3,4-dichlorophenyl)-3-methylidene-5-oxopyrazolidin-4-ylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | C=c1[nH]n(-c2ccc(Cl)c(Cl)c2)c(=O)/c1=C\c1ccc(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C20H16Cl2N2O4/c1-11-15(8-13-4-7-18(28-12(2)25)19(9-13)27-3)20(26)24(23-11)14-5-6-16(21)17(22)10-14/h4-10,23H,1H2,2-3H3/b15-8- |
| InChIKey | SDSCDTFRNUKXEC-NVNXTCNLSA-N |
| XLogP | 2.65 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|