C20H19N2O7S- — CID 2295756
4-[(4E)-3-methylidene-5-oxo-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrazolidin-1-yl]benzenesulfonate (PubChem CID 2295756) has the molecular formula C20H19N2O7S- and a molecular weight of 431.45 g/mol. Its IUPAC name is 4-[(4E)-3-methylidene-5-oxo-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrazolidin-1-yl]benzenesulfonate.
| Compound Name | 4-[(4E)-3-methylidene-5-oxo-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrazolidin-1-yl]benzenesulfonate |
|---|---|
| PubChem CID | 2295756 |
| Molecular Formula | C20H19N2O7S- |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 4-[(4E)-3-methylidene-5-oxo-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrazolidin-1-yl]benzenesulfonate |
| SMILES | C=c1[nH]n(-c2ccc(S(=O)(=O)[O-])cc2)c(=O)/c1=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H20N2O7S/c1-12-16(9-13-10-17(27-2)19(29-4)18(11-13)28-3)20(23)22(21-12)14-5-7-15(8-6-14)30(24,25)26/h5-11,21H,1H2,2-4H3,(H,24,25,26)/p-1/b16-9+ |
| InChIKey | LWNPKLRVPFYUCG-CXUHLZMHSA-M |
| XLogP | 0.33 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|