C19H14N3O6- — CID 2173818
4-[(4Z)-4-[(4-methoxy-3-nitrophenyl)methylidene]-3-methylidene-5-oxopyrazolidin-1-yl]benzoate (PubChem CID 2173818) has the molecular formula C19H14N3O6- and a molecular weight of 380.34 g/mol. Its IUPAC name is 4-[(4Z)-4-[(4-methoxy-3-nitrophenyl)methylidene]-3-methylidene-5-oxopyrazolidin-1-yl]benzoate.
| Compound Name | 4-[(4Z)-4-[(4-methoxy-3-nitrophenyl)methylidene]-3-methylidene-5-oxopyrazolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 2173818 |
| Molecular Formula | C19H14N3O6- |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-[(4Z)-4-[(4-methoxy-3-nitrophenyl)methylidene]-3-methylidene-5-oxopyrazolidin-1-yl]benzoate |
| SMILES | C=c1[nH]n(-c2ccc(C(=O)[O-])cc2)c(=O)/c1=C\c1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15N3O6/c1-11-15(9-12-3-8-17(28-2)16(10-12)22(26)27)18(23)21(20-11)14-6-4-13(5-7-14)19(24)25/h3-10,20H,1H2,2H3,(H,24,25)/p-1/b15-9- |
| InChIKey | ZEVOFLAACLGGBD-DHDCSXOGSA-M |
| XLogP | -0.31 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|