About 6-bromo-2-methylindazole
6-bromo-2-methylindazole (PubChem CID 22558624) has the molecular formula C8H7BrN2
and a molecular weight of 211.06 g/mol. Its IUPAC name is 6-bromo-2-methylindazole.
Molecular Properties
| Compound Name | 6-bromo-2-methylindazole |
| PubChem CID | 22558624 |
| Molecular Formula | C8H7BrN2 |
| Molecular Weight | 211.06 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 6-bromo-2-methylindazole |
| SMILES | Cn1cc2ccc(Br)cc2n1 |
| InChI | InChI=1S/C8H7BrN2/c1-11-5-6-2-3-7(9)4-8(6)10-11/h2-5H,1H3 |
| InChIKey | BVYFYDANLZQCPV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.06 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-2-methylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-methylindazole?
The IUPAC name of 6-bromo-2-methylindazole (CID 22558624) is 6-bromo-2-methylindazole.
What is the SMILES notation for 6-bromo-2-methylindazole?
The canonical SMILES for 6-bromo-2-methylindazole is Cn1cc2ccc(Br)cc2n1.
What is the InChIKey of 6-bromo-2-methylindazole?
The InChIKey is BVYFYDANLZQCPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2/c1-11-5-6-2-3-7(9)4-8(6)10-11/h2-5H,1H3.
What are the key properties of 6-bromo-2-methylindazole?
6-bromo-2-methylindazole has a molecular weight of 211.06 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-methylindazole is sourced from PubChem (CID 22558624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).