C13H15N3O2S — CID 22559540
1-(4-hydroxyphenyl)-3-(5-propan-2-yl-1,3-thiazol-2-yl)urea (PubChem CID 22559540) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-3-(5-propan-2-yl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(4-hydroxyphenyl)-3-(5-propan-2-yl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 22559540 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-(4-hydroxyphenyl)-3-(5-propan-2-yl-1,3-thiazol-2-yl)urea |
| SMILES | CC(C)c1cnc(NC(=O)Nc2ccc(O)cc2)s1 |
| InChI | InChI=1S/C13H15N3O2S/c1-8(2)11-7-14-13(19-11)16-12(18)15-9-3-5-10(17)6-4-9/h3-8,17H,1-2H3,(H2,14,15,16,18) |
| InChIKey | YZACKGVHBXSSRN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|