C14H17N3OS — CID 22559570
1-(4-methylphenyl)-3-(5-propan-2-yl-1,3-thiazol-2-yl)urea (PubChem CID 22559570) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(5-propan-2-yl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(4-methylphenyl)-3-(5-propan-2-yl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 22559570 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-(4-methylphenyl)-3-(5-propan-2-yl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ncc(C(C)C)s2)cc1 |
| InChI | InChI=1S/C14H17N3OS/c1-9(2)12-8-15-14(19-12)17-13(18)16-11-6-4-10(3)5-7-11/h4-9H,1-3H3,(H2,15,16,17,18) |
| InChIKey | KGRRAAAPLYYVLK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |