C24H21F2NO2S — CID 22565299
1-benzhydryl-3-[(2,3-difluorophenyl)-methylsulfonylmethylidene]azetidine (PubChem CID 22565299) has the molecular formula C24H21F2NO2S and a molecular weight of 425.50 g/mol. Its IUPAC name is 1-benzhydryl-3-[(2,3-difluorophenyl)-methylsulfonylmethylidene]azetidine.
| Compound Name | 1-benzhydryl-3-[(2,3-difluorophenyl)-methylsulfonylmethylidene]azetidine |
|---|---|
| PubChem CID | 22565299 |
| Molecular Formula | C24H21F2NO2S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 1-benzhydryl-3-[(2,3-difluorophenyl)-methylsulfonylmethylidene]azetidine |
| SMILES | CS(=O)(=O)C(=C1CN(C(c2ccccc2)c2ccccc2)C1)c1cccc(F)c1F |
| InChI | InChI=1S/C24H21F2NO2S/c1-30(28,29)24(20-13-8-14-21(25)22(20)26)19-15-27(16-19)23(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-14,23H,15-16H2,1H3 |
| InChIKey | JPCAQWRFPIVYOR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |