C27H23Cl2N3O3S — CID 2256691
(5Z)-3-[(2S)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]-5-[[4-(dimethylamino)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2256691) has the molecular formula C27H23Cl2N3O3S and a molecular weight of 540.47 g/mol. Its IUPAC name is (5Z)-3-[(2S)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]-5-[[4-(dimethylamino)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(2S)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]-5-[[4-(dimethylamino)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2256691 |
| Molecular Formula | C27H23Cl2N3O3S |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | (5Z)-3-[(2S)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]-5-[[4-(dimethylamino)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(C)c1ccc(/C=C2\SC(=O)N(C[C@@H](O)Cn3c4ccc(Cl)cc4c4cc(Cl)ccc43)C2=O)cc1 |
| InChI | InChI=1S/C27H23Cl2N3O3S/c1-30(2)19-7-3-16(4-8-19)11-25-26(34)32(27(35)36-25)15-20(33)14-31-23-9-5-17(28)12-21(23)22-13-18(29)6-10-24(22)31/h3-13,20,33H,14-15H2,1-2H3/b25-11-/t20-/m0/s1 |
| InChIKey | GAPBNWWKAXXVHI-FEIZOTCQSA-N |
| XLogP | 6.26 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|