C13H11Cl2NO3S — CID 163286067
3-(3-chloro-2-hydroxypropyl)-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 163286067) has the molecular formula C13H11Cl2NO3S and a molecular weight of 332.21 g/mol. Its IUPAC name is 3-(3-chloro-2-hydroxypropyl)-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-(3-chloro-2-hydroxypropyl)-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 163286067 |
| Molecular Formula | C13H11Cl2NO3S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 3-(3-chloro-2-hydroxypropyl)-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc(Cl)cc2)C(=O)N1CC(O)CCl |
| InChI | InChI=1S/C13H11Cl2NO3S/c14-6-10(17)7-16-12(18)11(20-13(16)19)5-8-1-3-9(15)4-2-8/h1-5,10,17H,6-7H2 |
| InChIKey | ZOBMSFYMNMEFRN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|