C24H25Cl2N3O3S — CID 142772758
(5Z)-3-[2-(4-chlorophenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 142772758) has the molecular formula C24H25Cl2N3O3S and a molecular weight of 506.46 g/mol. Its IUPAC name is (5Z)-3-[2-(4-chlorophenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(4-chlorophenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 142772758 |
| Molecular Formula | C24H25Cl2N3O3S |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | (5Z)-3-[2-(4-chlorophenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc(Cl)cc2)C(=O)N1CC(c1ccc(Cl)cc1)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C24H25Cl2N3O3S/c25-19-5-1-17(2-6-19)15-22-23(31)29(24(32)33-22)16-21(18-3-7-20(26)8-4-18)28-11-9-27(10-12-28)13-14-30/h1-8,15,21,30H,9-14,16H2/b22-15- |
| InChIKey | QHZHHHNKLGQLQG-JCMHNJIXSA-N |
| XLogP | 4.38 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|