C21H19ClFN3O2S — CID 16648576
(5E)-5-[(4-chlorophenyl)methylidene]-3-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 16648576) has the molecular formula C21H19ClFN3O2S and a molecular weight of 431.92 g/mol. Its IUPAC name is (5E)-5-[(4-chlorophenyl)methylidene]-3-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4-chlorophenyl)methylidene]-3-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 16648576 |
| Molecular Formula | C21H19ClFN3O2S |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | (5E)-5-[(4-chlorophenyl)methylidene]-3-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(Cl)cc2)C(=O)N1CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H19ClFN3O2S/c22-16-3-1-15(2-4-16)13-19-20(27)26(21(28)29-19)14-24-9-11-25(12-10-24)18-7-5-17(23)6-8-18/h1-8,13H,9-12,14H2/b19-13+ |
| InChIKey | VUDICKCZMFFKRL-CPNJWEJPSA-N |
| XLogP | 4.30 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|