C24H26N4O4S — CID 171132076
3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-5-[(4-propan-2-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 171132076) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is 3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-5-[(4-propan-2-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-5-[(4-propan-2-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 171132076 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-5-[(4-propan-2-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)c1ccc(C=C2SC(=O)N(CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H26N4O4S/c1-17(2)19-5-3-18(4-6-19)15-22-23(29)27(24(30)33-22)16-25-11-13-26(14-12-25)20-7-9-21(10-8-20)28(31)32/h3-10,15,17H,11-14,16H2,1-2H3 |
| InChIKey | OVGSVUHRUYTZFI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|