C26H20Cl2N2O4S — CID 2860646
3-[3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2860646) has the molecular formula C26H20Cl2N2O4S and a molecular weight of 527.43 g/mol. Its IUPAC name is 3-[3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2860646 |
| Molecular Formula | C26H20Cl2N2O4S |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | 3-[3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(C=C2SC(=O)N(CC(O)Cn3c4ccc(Cl)cc4c4cc(Cl)ccc43)C2=O)cc1 |
| InChI | InChI=1S/C26H20Cl2N2O4S/c1-34-19-6-2-15(3-7-19)10-24-25(32)30(26(33)35-24)14-18(31)13-29-22-8-4-16(27)11-20(22)21-12-17(28)5-9-23(21)29/h2-12,18,31H,13-14H2,1H3 |
| InChIKey | MIVQHLXUPUZKRX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|