C28H35N3O3S — CID 22573216
1-(1-phenyl-2-pyrrolidin-1-ylethyl)-6-(3-pyrrolidin-1-ylsulfonylphenyl)-5,6-dihydro-2H-azepin-7-one (PubChem CID 22573216) has the molecular formula C28H35N3O3S and a molecular weight of 493.67 g/mol. Its IUPAC name is 1-(1-phenyl-2-pyrrolidin-1-ylethyl)-6-(3-pyrrolidin-1-ylsulfonylphenyl)-5,6-dihydro-2H-azepin-7-one.
| Compound Name | 1-(1-phenyl-2-pyrrolidin-1-ylethyl)-6-(3-pyrrolidin-1-ylsulfonylphenyl)-5,6-dihydro-2H-azepin-7-one |
|---|---|
| PubChem CID | 22573216 |
| Molecular Formula | C28H35N3O3S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 1-(1-phenyl-2-pyrrolidin-1-ylethyl)-6-(3-pyrrolidin-1-ylsulfonylphenyl)-5,6-dihydro-2H-azepin-7-one |
| SMILES | O=C1C(c2cccc(S(=O)(=O)N3CCCC3)c2)CC=CCN1C(CN1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C28H35N3O3S/c32-28-26(24-13-10-14-25(21-24)35(33,34)30-18-8-9-19-30)15-4-5-20-31(28)27(22-29-16-6-7-17-29)23-11-2-1-3-12-23/h1-5,10-14,21,26-27H,6-9,15-20,22H2 |
| InChIKey | NKYJLIWHMCZXIF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|