C18H21N3O — CID 22573918
3-(5-phenoxy-3-pyridinyl)-3,7-diazabicyclo[3.3.1]nonane (PubChem CID 22573918) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-(5-phenoxy-3-pyridinyl)-3,7-diazabicyclo[3.3.1]nonane.
| Compound Name | 3-(5-phenoxy-3-pyridinyl)-3,7-diazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 22573918 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 3-(5-phenoxy-3-pyridinyl)-3,7-diazabicyclo[3.3.1]nonane |
| SMILES | c1ccc(Oc2cncc(N3CC4CNCC(C4)C3)c2)cc1 |
| InChI | InChI=1S/C18H21N3O/c1-2-4-17(5-3-1)22-18-7-16(10-20-11-18)21-12-14-6-15(13-21)9-19-8-14/h1-5,7,10-11,14-15,19H,6,8-9,12-13H2 |
| InChIKey | BPEHVDJRIBRLLY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |