C20H25N3O3 — CID 22045886
3-[5-(3,4-dimethoxyphenoxy)-3-pyridinyl]-3,6-diazabicyclo[3.2.2]nonane (PubChem CID 22045886) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-[5-(3,4-dimethoxyphenoxy)-3-pyridinyl]-3,6-diazabicyclo[3.2.2]nonane.
| Compound Name | 3-[5-(3,4-dimethoxyphenoxy)-3-pyridinyl]-3,6-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 22045886 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 3-[5-(3,4-dimethoxyphenoxy)-3-pyridinyl]-3,6-diazabicyclo[3.2.2]nonane |
| SMILES | COc1ccc(Oc2cncc(N3CC4CCC(C3)NC4)c2)cc1OC |
| InChI | InChI=1S/C20H25N3O3/c1-24-19-6-5-17(8-20(19)25-2)26-18-7-16(10-21-11-18)23-12-14-3-4-15(13-23)22-9-14/h5-8,10-11,14-15,22H,3-4,9,12-13H2,1-2H3 |
| InChIKey | INTFNCDMKLLKNF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |