C17H20ClN3O2 — CID 91607072
3-[5-(6-chlorocyclohexa-1,3-dien-1-yl)oxy-3-pyridinyl]-6-oxa-3,8-diazabicyclo[3.2.2]nonane (PubChem CID 91607072) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 3-[5-(6-chlorocyclohexa-1,3-dien-1-yl)oxy-3-pyridinyl]-6-oxa-3,8-diazabicyclo[3.2.2]nonane.
| Compound Name | 3-[5-(6-chlorocyclohexa-1,3-dien-1-yl)oxy-3-pyridinyl]-6-oxa-3,8-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 91607072 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 3-[5-(6-chlorocyclohexa-1,3-dien-1-yl)oxy-3-pyridinyl]-6-oxa-3,8-diazabicyclo[3.2.2]nonane |
| SMILES | ClC1CC=CC=C1Oc1cncc(N2CC3COC(CN3)C2)c1 |
| InChI | InChI=1S/C17H20ClN3O2/c18-16-3-1-2-4-17(16)23-14-5-13(6-19-7-14)21-9-12-11-22-15(10-21)8-20-12/h1-2,4-7,12,15-16,20H,3,8-11H2 |
| InChIKey | YRWUURUOQNWMKU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|