C17H19ClFN3 — CID 89166013
3-[5-(3-chloro-4-fluorocyclohexa-1,5-dien-1-yl)-3-pyridinyl]-3,6-diazabicyclo[3.2.1]octane (PubChem CID 89166013) has the molecular formula C17H19ClFN3 and a molecular weight of 319.81 g/mol. Its IUPAC name is 3-[5-(3-chloro-4-fluorocyclohexa-1,5-dien-1-yl)-3-pyridinyl]-3,6-diazabicyclo[3.2.1]octane.
| Compound Name | 3-[5-(3-chloro-4-fluorocyclohexa-1,5-dien-1-yl)-3-pyridinyl]-3,6-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 89166013 |
| Molecular Formula | C17H19ClFN3 |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3-[5-(3-chloro-4-fluorocyclohexa-1,5-dien-1-yl)-3-pyridinyl]-3,6-diazabicyclo[3.2.1]octane |
| SMILES | FC1C=CC(c2cncc(N3CC4CNC(C4)C3)c2)=CC1Cl |
| InChI | InChI=1S/C17H19ClFN3/c18-16-5-12(1-2-17(16)19)13-4-15(8-20-7-13)22-9-11-3-14(10-22)21-6-11/h1-2,4-5,7-8,11,14,16-17,21H,3,6,9-10H2 |
| InChIKey | LSNXQUZKGIPYPV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|