C16H20N4O2 — CID 156824030
4-(3,6-diazabicyclo[3.2.1]octan-3-yl)-6,7-dimethoxyquinazoline (PubChem CID 156824030) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-(3,6-diazabicyclo[3.2.1]octan-3-yl)-6,7-dimethoxyquinazoline.
| Compound Name | 4-(3,6-diazabicyclo[3.2.1]octan-3-yl)-6,7-dimethoxyquinazoline |
|---|---|
| PubChem CID | 156824030 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 4-(3,6-diazabicyclo[3.2.1]octan-3-yl)-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2ncnc(N3CC4CNC(C4)C3)c2cc1OC |
| InChI | InChI=1S/C16H20N4O2/c1-21-14-4-12-13(5-15(14)22-2)18-9-19-16(12)20-7-10-3-11(8-20)17-6-10/h4-5,9-11,17H,3,6-8H2,1-2H3 |
| InChIKey | OJICDWIRACLTTQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |