C23H28N4O2 — CID 11654032
4-benzyl-1-(6,7-dimethoxyquinazolin-4-yl)-N,N-dimethylpyrrolidin-3-amine (PubChem CID 11654032) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-benzyl-1-(6,7-dimethoxyquinazolin-4-yl)-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 4-benzyl-1-(6,7-dimethoxyquinazolin-4-yl)-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 11654032 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 4-benzyl-1-(6,7-dimethoxyquinazolin-4-yl)-N,N-dimethylpyrrolidin-3-amine |
| SMILES | COc1cc2ncnc(N3CC(Cc4ccccc4)C(N(C)C)C3)c2cc1OC |
| InChI | InChI=1S/C23H28N4O2/c1-26(2)20-14-27(13-17(20)10-16-8-6-5-7-9-16)23-18-11-21(28-3)22(29-4)12-19(18)24-15-25-23/h5-9,11-12,15,17,20H,10,13-14H2,1-4H3 |
| InChIKey | OEHOEWMYSWNNLN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |