C21H23BrN2O4S — CID 22574724
2-[4-(bromomethyl)-2-methylphenyl]-N-(4,5-dimethyl-1,2-oxazol-3-yl)-N-(methoxymethyl)benzenesulfonamide (PubChem CID 22574724) has the molecular formula C21H23BrN2O4S and a molecular weight of 479.40 g/mol. Its IUPAC name is 2-[4-(bromomethyl)-2-methylphenyl]-N-(4,5-dimethyl-1,2-oxazol-3-yl)-N-(methoxymethyl)benzenesulfonamide.
| Compound Name | 2-[4-(bromomethyl)-2-methylphenyl]-N-(4,5-dimethyl-1,2-oxazol-3-yl)-N-(methoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22574724 |
| Molecular Formula | C21H23BrN2O4S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 2-[4-(bromomethyl)-2-methylphenyl]-N-(4,5-dimethyl-1,2-oxazol-3-yl)-N-(methoxymethyl)benzenesulfonamide |
| SMILES | COCN(c1noc(C)c1C)S(=O)(=O)c1ccccc1-c1ccc(CBr)cc1C |
| InChI | InChI=1S/C21H23BrN2O4S/c1-14-11-17(12-22)9-10-18(14)19-7-5-6-8-20(19)29(25,26)24(13-27-4)21-15(2)16(3)28-23-21/h5-11H,12-13H2,1-4H3 |
| InChIKey | PCGZCTSCYFCKKB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|