C22H26N2O5S — CID 22574896
N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-[2-ethyl-4-(hydroxymethyl)phenyl]-N-(methoxymethyl)benzenesulfonamide (PubChem CID 22574896) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-[2-ethyl-4-(hydroxymethyl)phenyl]-N-(methoxymethyl)benzenesulfonamide.
| Compound Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-[2-ethyl-4-(hydroxymethyl)phenyl]-N-(methoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22574896 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-[2-ethyl-4-(hydroxymethyl)phenyl]-N-(methoxymethyl)benzenesulfonamide |
| SMILES | CCc1cc(CO)ccc1-c1ccccc1S(=O)(=O)N(COC)c1noc(C)c1C |
| InChI | InChI=1S/C22H26N2O5S/c1-5-18-12-17(13-25)10-11-19(18)20-8-6-7-9-21(20)30(26,27)24(14-28-4)22-15(2)16(3)29-23-22/h6-12,25H,5,13-14H2,1-4H3 |
| InChIKey | AHKMGQGPDMVCTD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|