C16H20N2OS — CID 22575169
1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(3-methylphenyl)urea (PubChem CID 22575169) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 22575169 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-[2-(4,5-dimethylthiophen-3-yl)ethyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NCCc2csc(C)c2C)c1 |
| InChI | InChI=1S/C16H20N2OS/c1-11-5-4-6-15(9-11)18-16(19)17-8-7-14-10-20-13(3)12(14)2/h4-6,9-10H,7-8H2,1-3H3,(H2,17,18,19) |
| InChIKey | BSFFAHHWEWEVJP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |