C20H14N4O6S2 — CID 2257612
N-[4-hydroxy-5-(2-oxoindol-3-yl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]-4-nitrobenzenesulfonamide (PubChem CID 2257612) has the molecular formula C20H14N4O6S2 and a molecular weight of 470.49 g/mol. Its IUPAC name is N-[4-hydroxy-5-(2-oxoindol-3-yl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]-4-nitrobenzenesulfonamide.
| Compound Name | N-[4-hydroxy-5-(2-oxoindol-3-yl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2257612 |
| Molecular Formula | C20H14N4O6S2 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | N-[4-hydroxy-5-(2-oxoindol-3-yl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]-4-nitrobenzenesulfonamide |
| SMILES | C=CCn1c(O)c(C2=c3ccccc3=NC2=O)sc1=NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H14N4O6S2/c1-2-11-23-19(26)17(16-14-5-3-4-6-15(14)21-18(16)25)31-20(23)22-32(29,30)13-9-7-12(8-10-13)24(27)28/h2-10,26H,1,11H2 |
| InChIKey | OGKROAUEJNVWOE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 144.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|