C24H24N4OS — CID 22577904
N-(1-benzylpiperidin-4-yl)-3-pyrrol-1-ylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 22577904) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-pyrrol-1-ylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-pyrrol-1-ylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 22577904 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-pyrrol-1-ylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1sc2ncccc2c1-n1cccc1 |
| InChI | InChI=1S/C24H24N4OS/c29-23(26-19-10-15-27(16-11-19)17-18-7-2-1-3-8-18)22-21(28-13-4-5-14-28)20-9-6-12-25-24(20)30-22/h1-9,12-14,19H,10-11,15-17H2,(H,26,29) |
| InChIKey | XQRHLTBMTVXMBD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |