C27H36N6O3 — CID 22579826
N-benzyl-4-[2-[3-(4-ethylpiperazin-1-yl)propylamino]-2-oxoethyl]-3-oxo-2H-quinoxaline-1-carboxamide (PubChem CID 22579826) has the molecular formula C27H36N6O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is N-benzyl-4-[2-[3-(4-ethylpiperazin-1-yl)propylamino]-2-oxoethyl]-3-oxo-2H-quinoxaline-1-carboxamide.
| Compound Name | N-benzyl-4-[2-[3-(4-ethylpiperazin-1-yl)propylamino]-2-oxoethyl]-3-oxo-2H-quinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 22579826 |
| Molecular Formula | C27H36N6O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | N-benzyl-4-[2-[3-(4-ethylpiperazin-1-yl)propylamino]-2-oxoethyl]-3-oxo-2H-quinoxaline-1-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)CN2C(=O)CN(C(=O)NCc3ccccc3)c3ccccc32)CC1 |
| InChI | InChI=1S/C27H36N6O3/c1-2-30-15-17-31(18-16-30)14-8-13-28-25(34)20-32-23-11-6-7-12-24(23)33(21-26(32)35)27(36)29-19-22-9-4-3-5-10-22/h3-7,9-12H,2,8,13-21H2,1H3,(H,28,34)(H,29,36) |
| InChIKey | PCTPYMUEMXZPNS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|