C23H22N4O4 — CID 22579787
N-benzyl-4-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-oxo-2H-quinoxaline-1-carboxamide (PubChem CID 22579787) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-benzyl-4-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-oxo-2H-quinoxaline-1-carboxamide.
| Compound Name | N-benzyl-4-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-oxo-2H-quinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 22579787 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-benzyl-4-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-oxo-2H-quinoxaline-1-carboxamide |
| SMILES | O=C(CN1C(=O)CN(C(=O)NCc2ccccc2)c2ccccc21)NCc1ccco1 |
| InChI | InChI=1S/C23H22N4O4/c28-21(24-14-18-9-6-12-31-18)15-26-19-10-4-5-11-20(19)27(16-22(26)29)23(30)25-13-17-7-2-1-3-8-17/h1-12H,13-16H2,(H,24,28)(H,25,30) |
| InChIKey | JWFLCLMOAYDPOP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |