C15H14N2O4 — CID 2145420
N-(furan-2-ylmethyl)-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide (PubChem CID 2145420) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 2145420 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1CC(=O)Oc2ccccc21)NCc1ccco1 |
| InChI | InChI=1S/C15H14N2O4/c18-14(16-8-11-4-3-7-20-11)9-17-10-15(19)21-13-6-2-1-5-12(13)17/h1-7H,8-10H2,(H,16,18) |
| InChIKey | MIZFYLTUIYNNTA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|